2980-33-8 2-Hydroxy-3,5-dinitropyridine |
| Product Name |
2-Hydroxy-3,5-dinitropyridine |
| Synonyms |
3,5-Dinitro-2-pyridinol;3,5-Dinitro-2-hydroxypyridine;3,5-dinitropyridin-2(1H)-one;5-nitro-6-oxo-1,6-dihydropyridine-3-carboxylic acid |
| Molecular Formula |
C6H4N2O5 |
| Molecular Weight |
184.1064 |
| InChl |
InChI=1/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) |
| CAS Registry Number |
2980-33-8 |
| Molecular Structure |
 |
| Density |
1.7g/cm3 |
| Boiling Point |
363.6°C at 760 mmHg |
| Refractive Index |
1.634 |
| Flash Point |
173.7°C |
| Vapour Pressur |
2.82E-06mmHg at 25°C |
| Risk Codes |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:;
|
