100796-79-0 Diethyl (benzotriazol-1-yl)iminomalonate |
| Product Name |
Diethyl (benzotriazol-1-yl)iminomalonate |
| Synonyms |
diethyl (1H-benzotriazol-1-ylimino)propanedioate |
| Molecular Formula |
C13H14N4O4 |
| Molecular Weight |
290.2747 |
| InChl |
InChI=1/C13H14N4O4/c1-3-20-12(18)11(13(19)21-4-2)15-17-10-8-6-5-7-9(10)14-16-17/h5-8H,3-4H2,1-2H3 |
| CAS Registry Number |
100796-79-0 |
| Molecular Structure |
 |
| Density |
1.34g/cm3 |
| Boiling Point |
413°C at 760 mmHg |
| Refractive Index |
1.608 |
| Flash Point |
203.6°C |
| Vapour Pressur |
4.97E-07mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
