102170-56-9 2-Bromo-6-methyl-4-nitroaniline |
|
| Product Name | 2-Bromo-6-methyl-4-nitroaniline |
| Molecular Formula | C7H7BrN2O2 |
| Molecular Weight | 231.0467 |
| InChl | InChI=1/C7H7BrN2O2/c1-4-2-5(10(11)12)3-6(8)7(4)9/h2-3H,9H2,1H3 |
| CAS Registry Number | 102170-56-9 |
| Molecular Structure |  |
| Density | 1.698g/cm3 |
| Melting Point | 177-181℃ |
| Boiling Point | 366°C at 760 mmHg |
| Refractive Index | 1.648 |
| Flash Point | 175.2°C |
| Vapour Pressur | 1.51E-05mmHg at 25°C |
| Hazard Symbols |  Xn##Harmful:; |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.:; |
- Dandong Gilkuhn Import&Export Co., Ltd.
TEL:0519-83607890
FAX:0519-83607890 - Durham Organics Limited
TEL:+44 (0)191 378 2973
FAX:+44 (0)191 378 2973
