111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol |
|
| Product Name | (2-methyl-5-phenyl-3-furyl)methanol |
| Synonyms | (2-methyl-5-phenylfuran-3-yl)methanol |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.2225 |
| InChl | InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
| CAS Registry Number | 111787-91-8 |
| Molecular Structure |  |
| Density | 1.123g/cm3 |
| Melting Point | 22℃ |
| Boiling Point | 233.9°C at 760 mmHg |
| Refractive Index | 1.562 |
| Flash Point | 95.2°C |
| Vapour Pressur | 0.0302mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Beijing Ouhe Technology Co., Ltd.
TEL:0086-10-87149610 88459036
FAX:0086-10-88459036
