127142-69-2 2,3,4-Trichlorophenyl isothiocyanate |
| Product Name |
2,3,4-Trichlorophenyl isothiocyanate |
| Synonyms |
2,3,4-Trichloroisothiocyanatobenzene;1,2,3-trichloro-4-isothiocyanatobenzene |
| Molecular Formula |
C7H2Cl3NS |
| Molecular Weight |
238.5215 |
| InChl |
InChI=1/C7H2Cl3NS/c8-4-1-2-5(11-3-12)7(10)6(4)9/h1-2H |
| CAS Registry Number |
127142-69-2 |
| Molecular Structure |
 |
| Density |
1.5g/cm3 |
| Boiling Point |
335.4°C at 760 mmHg |
| Refractive Index |
1.633 |
| Flash Point |
156.6°C |
| Vapour Pressur |
0.000234mmHg at 25°C |
| Risk Codes |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:;
|
