135-00-2 2-Benzoylthiophene |
| Product Name |
2-Benzoylthiophene |
| Synonyms |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone);Phenyl 2-thienyl ketone;phenyl(thiophen-2-yl)methanone |
| Molecular Formula |
C11H8OS |
| Molecular Weight |
188.2456 |
| InChl |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| CAS Registry Number |
135-00-2 |
| EINECS |
205-169-6 |
| Molecular Structure |
 |
| Density |
1.198g/cm3 |
| Boiling Point |
300°C at 760 mmHg |
| Refractive Index |
1.609 |
| Flash Point |
139.7°C |
| Vapour Pressur |
0.00115mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
