13679-72-6 2-acetyl-3-methylthiophene |
|
| Product Name | 2-acetyl-3-methylthiophene |
| Synonyms | 1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.2028 |
| InChl | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| CAS Registry Number | 13679-72-6 |
| EINECS | 237-179-1 |
| Molecular Structure |  |
| Density | 1.106g/cm3 |
| Boiling Point | 214.9°C at 760 mmHg |
| Refractive Index | 1.535 |
| Flash Point | 92.3°C |
| Vapour Pressur | 0.152mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.:; |
- Trademax Pharmaceuticals & Chemicals Co..Ltd.
TEL:86 21 52387770, 52387772, 52387128
FAX:86-21-52387129 - AFINE CHEMICALS LIMITED
TEL:86-571-85232125 85232161 85134551
FAX:86-571-85134895 - Parish Chemical
TEL:(801) 226-2018
FAX:(801) 226-8496
