13679-73-7 2-Acetyl-4-methylthiophene |
| Product Name |
2-Acetyl-4-methylthiophene |
| Synonyms |
1-(4-Methyl-2-thienyl)ethan-1-one;AI3-61742;Ethanone, 1-(4-methyl-2-thienyl)-;1-(4-methylthiophen-2-yl)ethanone |
| Molecular Formula |
C7H8OS |
| Molecular Weight |
140.2028 |
| InChl |
InChI=1/C7H8OS/c1-5-3-7(6(2)8)9-4-5/h3-4H,1-2H3 |
| CAS Registry Number |
13679-73-7 |
| EINECS |
237-180-7 |
| Molecular Structure |
 |
| Density |
1.106g/cm3 |
| Boiling Point |
236.9°C at 760 mmHg |
| Refractive Index |
1.535 |
| Flash Point |
97.1°C |
| Vapour Pressur |
0.0461mmHg at 25°C |
| Risk Codes |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:;
|
| Safety Description |
S36/37##Wear suitable protective clothing and gloves.:;
|
