1501-27-5 mono-methyl glutarate |
Product Name |
mono-methyl glutarate |
Synonyms |
Methyl hydrogen glutarate;Glutaric acid monomethyl ester;Monomethyl glutarate;Pentanedioic acid monomethyl ester;Monoethyl Glutaric Acid;5-methoxy-5-oxopentanoic acid;5-methoxy-5-oxopentanoate;5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid |
Molecular Formula |
C15H26O4 |
Molecular Weight |
270.3645 |
InChl |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
CAS Registry Number |
1501-27-5 |
EINECS |
216-116-1 |
Molecular Structure |
|
Density |
1.05g/cm3 |
Boiling Point |
393.406°C at 760 mmHg |
Refractive Index |
1.478 |
Flash Point |
137.448°C |
Vapour Pressur |
0mmHg at 25°C |
Risk Codes |
R36/38##Irritating to eyes and skin.:;
|
Safety Description |
S23||S24/25:;
|