15219-34-8 Oxalyl bromide |
|
| Product Name | Oxalyl bromide |
| Synonyms | Ethanedioyl dibromide;Ethanedioyl bromide;NSC 96957;Oxalyl bromide |
| Molecular Formula | C2Br2O2 |
| Molecular Weight | 215.8282 |
| InChl | InChI=1/C2Br2O2/c3-1(5)2(4)6 |
| CAS Registry Number | 15219-34-8 |
| EINECS | 239-271-7 |
| Molecular Structure |  |
| Density | 2.627g/cm3 |
| Melting Point | -19℃ |
| Boiling Point | 118.3°C at 760 mmHg |
| Refractive Index | 1.567 |
| Flash Point | 109.8°C |
| Vapour Pressur | 16.8mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- R. W. Greeff
TEL:(203)541-9200
FAX:(203)541-9191