157373-08-5 2,3,4-trifluorobenzoyl chloride |
|
| Product Name | 2,3,4-trifluorobenzoyl chloride |
| Molecular Formula | C7H2ClF3O |
| Molecular Weight | 194.5384 |
| InChl | InChI=1/C7H2ClF3O/c8-7(12)3-1-2-4(9)6(11)5(3)10/h1-2H |
| CAS Registry Number | 157373-08-5 |
| Molecular Structure |  |
| Density | 1.514g/cm3 |
| Boiling Point | 203.2°C at 760 mmHg |
| Refractive Index | 1.479 |
| Flash Point | 60.4°C |
| Vapour Pressur | 0.28mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R34##Causes burns.||R36/37##Irritating to eyes and respiratory system.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- Capot Chemical Co., Ltd.
TEL:0086-571-85586718
FAX:0086-571-85864795 - Shanghai Worldyang Chemical Co., Limited
TEL:+86-21-56795766,56795797
FAX:+86- - Chordip LTD
TEL:+44 (0) 1642 564465
FAX:+44 (0) 1642 202000