16789-84-7 3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
|
| Product Name | 3-Bromo-2-hydroxy-5-nitrobenzaldehyde |
| Synonyms | 3-Bromo-5-nitrosalicylaldehyde |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.015 |
| InChl | InChI=1/C7H4BrNO4/c8-6-2-5(9(12)13)1-4(3-10)7(6)11/h1-3,11H |
| CAS Registry Number | 16789-84-7 |
| Molecular Structure |  |
| Density | 1.928g/cm3 |
| Boiling Point | 299.6°C at 760 mmHg |
| Refractive Index | 1.696 |
| Flash Point | 135°C |
| Vapour Pressur | 0.000662mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- Hangzhou Shuyuan Pharmaceutical Technology Co., Ltd.
TEL:0571-86066502;18958062155
FAX:0571-86066502
