187657-92-7 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
|
| Product Name | 1-(1-benzofuran-3-yl)-2-bromo-1-ethanone |
| Synonyms | [2,4-bis(methylsulfonyl)phenyl]hydrazine;1-(1-benzofuran-3-yl)-2-bromoethanone |
| Molecular Formula | C10H7BrO2 |
| Molecular Weight | 239.0654 |
| InChl | InChI=1/C10H7BrO2/c11-5-9(12)8-6-13-10-4-2-1-3-7(8)10/h1-4,6H,5H2 |
| CAS Registry Number | 187657-92-7 |
| EINECS | 260-718-7 |
| Molecular Structure |  |
| Density | 1.582g/cm3 |
| Melting Point | 136℃ |
| Boiling Point | 306.8°C at 760 mmHg |
| Refractive Index | 1.636 |
| Flash Point | 139.3°C |
| Vapour Pressur | 0.000755mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- PFL
TEL:+49 214 302 4490
FAX: - PFL Fine Chemicals GmbH
TEL:+49 (0)214 3024490
FAX:+49 (0)214 3024149
