20300-02-1 Thiophene-2-thiocarboxamide |
|
| Product Name | Thiophene-2-thiocarboxamide |
| Synonyms | Thiophene-2-carbothioamide |
| Molecular Formula | C5H5NS2 |
| Molecular Weight | 143.2299 |
| InChl | InChI=1/C5H5NS2/c6-5(7)4-2-1-3-8-4/h1-3H,(H2,6,7) |
| CAS Registry Number | 20300-02-1 |
| Molecular Structure |  |
| Density | 1.357g/cm3 |
| Melting Point | 106℃ |
| Boiling Point | 259.5°C at 760 mmHg |
| Refractive Index | 1.701 |
| Flash Point | 110.7°C |
| Vapour Pressur | 0.0129mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R25##Toxic if swallowed.:; |
| Safety Description | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- Lotus Specialty Chemicals, LLC
TEL:877-816-9258 (+1-603-718-8771)
FAX:603-718-8772
