20349-89-7 Methyl 3-(2-hydroxyphenyl)propionate |
|
| Product Name | Methyl 3-(2-hydroxyphenyl)propionate |
| Synonyms | Methyl 3-(2-hydroxyphenyl)propanoate |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.2005 |
| InChl | InChI=1/C10H12O3/c1-13-10(12)7-6-8-4-2-3-5-9(8)11/h2-5,11H,6-7H2,1H3 |
| CAS Registry Number | 20349-89-7 |
| Molecular Structure |  |
| Density | 1.146g/cm3 |
| Melting Point | 40℃ |
| Boiling Point | 280.2°C at 760 mmHg |
| Refractive Index | 1.532 |
| Flash Point | 116.6°C |
| Vapour Pressur | 0.00225mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Alfa Aesar
TEL:1-800-343-7276
FAX:1-978-521-6366
