208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene |
|
| Product Name | 5-Chloro-1,2-dibromo-3-fluorobenzene |
| Synonyms | 5-Chloro-2,3-dibromo-1-fluorobenzene;1,2-Dibromo-5-chloro-3-fluorobenzene;1,2-Dibromo-5-chloro-3-fluorobenzene |
| Molecular Formula | C6H2Br2ClF |
| Molecular Weight | 288.3395 |
| InChl | InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
| CAS Registry Number | 208186-78-1 |
| Molecular Structure |  |
| Density | 2.089g/cm3 |
| Boiling Point | 245.3°C at 760 mmHg |
| Refractive Index | 1.589 |
| Flash Point | 102.1°C |
| Vapour Pressur | 0.0454mmHg at 25°C |
| Risk Codes | R36/38##Irritating to eyes and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- Hangzhou Shuyuan Pharmaceutical Technology Co., Ltd.
TEL:0571-86066502;18958062155
FAX:0571-86066502 - Alfa Aesar
TEL:1-800-343-7276
FAX:1-978-521-6366
