2113-58-8 3-Nitrobiphenyl |
|
| Product Name | 3-Nitrobiphenyl |
| Synonyms | 3-Nitrodiphenyl |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.2054 |
| InChl | InChI=1/C12H9NO2/c14-13(15)12-8-4-7-11(9-12)10-5-2-1-3-6-10/h1-9H |
| CAS Registry Number | 2113-58-8 |
| EINECS | 218-305-4 |
| Molecular Structure |  |
| Density | 1.196g/cm3 |
| Melting Point | 56-60℃ |
| Boiling Point | 339°C at 760 mmHg |
| Refractive Index | 1.605 |
| Flash Point | 161.4°C |
| Vapour Pressur | 0.000186mmHg at 25°C |
| Hazard Symbols |  Xn##Harmful:; |
| Risk Codes | R40##Possible risks of irreversible effects.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- Frinton Laboratories
TEL:+1-877-374-6866
FAX:+1 856 439-1977 - Frinton Laboratories, Inc.
TEL:856-722-7037
FAX:856-439-1977 - Panamit International
TEL:0091-22-22011933
FAX:0091-22-22056114
