2211-94-1 2,3-Epoxypropyl-4'-methoxyphenyl ether |
| Product Name |
2,3-Epoxypropyl-4'-methoxyphenyl ether |
| Synonyms |
Glycidyl p-methoxyphenyl ether;2,3-epoxypropyl-4-methoxyphenyl ether;2-[(4-methoxyphenoxy)methyl]oxirane;(2R)-2-[(4-methoxyphenoxy)methyl]oxirane;(2S)-2-[(4-methoxyphenoxy)methyl]oxirane |
| Molecular Formula |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChl |
InChI=1/C10H12O3/c1-11-8-2-4-9(5-3-8)12-6-10-7-13-10/h2-5,10H,6-7H2,1H3/t10-/m1/s1 |
| CAS Registry Number |
2211-94-1 |
| EINECS |
218-653-7 |
| Molecular Structure |
 |
| Density |
1.142g/cm3 |
| Melting Point |
45-48℃ |
| Boiling Point |
287.9°C at 760 mmHg |
| Refractive Index |
1.526 |
| Flash Point |
95.5°C |
| Vapour Pressur |
0.00417mmHg at 25°C |
| Hazard Symbols |
 Xi##Irritant:;
|
| Risk Codes |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
| Safety Description |
S24/25##Avoid contact with skin and eyes.||S7/9##Keep container tightly closed and in a well-ventilated place.:;
|
