2338-71-8 5-fluoroindole-3-carboxaldehyde |
|
| Product Name | 5-fluoroindole-3-carboxaldehyde |
| Synonyms | 5-Fluoro-3-formylindole;5-fluoro-1H-indole-3-carbaldehyde |
| Molecular Formula | C9H6FNO |
| Molecular Weight | 163.1484 |
| InChl | InChI=1/C9H6FNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H |
| CAS Registry Number | 2338-71-8 |
| Molecular Structure |  |
| Density | 1.385g/cm3 |
| Boiling Point | 342.4°C at 760 mmHg |
| Refractive Index | 1.695 |
| Flash Point | 160.9°C |
| Vapour Pressur | 7.53E-05mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- Yixing Zhongyu Medicine Technology Co.,Ltd.
TEL:+86-510-87688158
FAX:+86-510-87686999
