2401-24-3 6-Chloro-m-anisidine |
| Product Name |
6-Chloro-m-anisidine |
| Synonyms |
2-Chloro-5-methoxyaniline;6-chloro-meta-anisidine;3-Amino-4-chloroanisole |
| Molecular Formula |
C7H9Cl2NO |
| Molecular Weight |
194.0585 |
| InChl |
InChI=1/C7H8ClNO.ClH/c1-10-5-2-3-6(8)7(9)4-5;/h2-4H,9H2,1H3;1H |
| CAS Registry Number |
2401-24-3 |
| EINECS |
219-277-6 |
| Molecular Structure |
 |
| Melting Point |
207℃ |
| Boiling Point |
255°C at 760 mmHg |
| Flash Point |
108°C |
| Vapour Pressur |
0.0168mmHg at 25°C |
| Hazard Symbols |
 Xn##Harmful:;
|
| Risk Codes |
R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:;
|
| Safety Description |
S36/37##Wear suitable protective clothing and gloves.:;
|
