24662-24-6 1-benzothiophene-3-carbothioamide |
|
| Product Name | 1-benzothiophene-3-carbothioamide |
| Molecular Formula | C9H7NS2 |
| Molecular Weight | 193.2886 |
| InChl | InChI=1/C9H7NS2/c10-9(11)7-5-12-8-4-2-1-3-6(7)8/h1-5H,(H2,10,11) |
| CAS Registry Number | 24662-24-6 |
| Molecular Structure |  |
| Density | 1.384g/cm3 |
| Melting Point | 109℃ |
| Boiling Point | 364.8°C at 760 mmHg |
| Refractive Index | 1.781 |
| Flash Point | 174.4°C |
| Vapour Pressur | 1.64E-05mmHg at 25°C |
| Hazard Symbols |  Xn##Harmful:; |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S36/37##Wear suitable protective clothing and gloves.:; |
- J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431