30934-97-5 Glycolaldehyde dimethyl acetal |
| Product Name |
Glycolaldehyde dimethyl acetal |
| Synonyms |
2,2-Dimethoxyethanol~Hydroxyacetaldehyde dimethyl acetal;2,2-Dimethoxyethanol;2,3-dimethoxy ethanol |
| Molecular Formula |
C4H10O3 |
| Molecular Weight |
106.1204 |
| InChl |
InChI=1/C4H10O3/c1-6-4(3-5)7-2/h4-5H,3H2,1-2H3 |
| CAS Registry Number |
30934-97-5 |
| EINECS |
250-398-7 |
| Molecular Structure |
 |
| Density |
1.009g/cm3 |
| Boiling Point |
146.1°C at 760 mmHg |
| Refractive Index |
1.401 |
| Flash Point |
42.2°C |
| Vapour Pressur |
1.85mmHg at 25°C |
| Safety Description |
S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:;
|
