30955-94-3 2-Acetyl-5-iodothiophene |
|
| Product Name | 2-Acetyl-5-iodothiophene |
| Synonyms | NSC 80387;1-(5-iodothiophen-2-yl)ethanone |
| Molecular Formula | C6H5IOS |
| Molecular Weight | 252.0728 |
| InChl | InChI=1/C6H5IOS/c1-4(8)5-2-3-6(7)9-5/h2-3H,1H3 |
| CAS Registry Number | 30955-94-3 |
| Molecular Structure |  |
| Density | 1.902g/cm3 |
| Boiling Point | 306.2°C at 760 mmHg |
| Refractive Index | 1.637 |
| Flash Point | 139°C |
| Vapour Pressur | 0.000785mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431 - Isotec
TEL: 1-937-859-1808
FAX: 1-937-859-4878
