37107-50-9 Cyclohexylidenecyanoacetic acid |
|
| Product Name | Cyclohexylidenecyanoacetic acid |
| Synonyms | Cyanocyclohexylideneacetic acid;2-Cyano-2-cyclohexylidene-acetic acid |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.1891 |
| InChl | InChI=1/C9H11NO2/c10-6-8(9(11)12)7-4-2-1-3-5-7/h1-5H2,(H,11,12) |
| CAS Registry Number | 37107-50-9 |
| EINECS | 253-351-9 |
| Molecular Structure |  |
| Density | 1.211g/cm3 |
| Boiling Point | 353.9°C at 760 mmHg |
| Refractive Index | 1.537 |
| Flash Point | 167.8°C |
| Vapour Pressur | 5.84E-06mmHg at 25°C |
| Risk Codes | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
- Abydos Scientific
TEL:+86-25-84767922
FAX:+86-25-85235797 - J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431