39244-10-5 3-(3-Furyl)acrylic acid |
|
| Product Name | 3-(3-Furyl)acrylic acid |
| Synonyms | Furan-3-acrylic acid;(2E)-3-(furan-3-yl)prop-2-enoic acid;3-Furanacrylic acid;3-Furanylacrylic acid |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.1207 |
| InChl | InChI=1/C7H6O3/c8-7(9)2-1-6-3-4-10-5-6/h1-5H,(H,8,9)/b2-1+ |
| CAS Registry Number | 39244-10-5 |
| Molecular Structure |  |
| Density | 1.28g/cm3 |
| Boiling Point | 261.4°C at 760 mmHg |
| Refractive Index | 1.582 |
| Flash Point | 111.9°C |
| Vapour Pressur | 0.00587mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- Hangzhou Pharma & Chem Co.,Ltd.
TEL:+86-571-87040515
FAX:+86-571-87214761
