423768-55-2 (2-morpholino-3-pyridinyl)methanol |
|
| Product Name | (2-morpholino-3-pyridinyl)methanol |
| Synonyms | (2-morpholin-4-ylpyridin-3-yl)methanol |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.2304 |
| InChl | InChI=1/C10H14N2O2/c13-8-9-2-1-3-11-10(9)12-4-6-14-7-5-12/h1-3,13H,4-8H2 |
| CAS Registry Number | 423768-55-2 |
| Molecular Structure |  |
| Density | 1.215g/cm3 |
| Melting Point | 78℃ |
| Boiling Point | 397°C at 760 mmHg |
| Refractive Index | 1.572 |
| Flash Point | 193.9°C |
| Vapour Pressur | 5.15E-07mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Beijing Ouhe Technology Co., Ltd.
TEL:0086-10-87149610 88459036
FAX:0086-10-88459036
