42877-08-7 2-Acetyl-3-bromothiophene |
|
| Product Name | 2-Acetyl-3-bromothiophene |
| Synonyms | 1-(3-bromothiophen-2-yl)ethanone |
| Molecular Formula | C6H5BrOS |
| Molecular Weight | 205.0723 |
| InChl | InChI=1/C6H5BrOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| CAS Registry Number | 42877-08-7 |
| Molecular Structure |  |
| Density | 1.619g/cm3 |
| Boiling Point | 283.5°C at 760 mmHg |
| Refractive Index | 1.583 |
| Flash Point | 125.3°C |
| Vapour Pressur | 0.00314mmHg at 25°C |
| Risk Codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- Shanghai Rainbow Chemicals Co., Ltd.,
TEL:021-64965859
FAX:021-64968087
