465514-33-4 (2-morpholinophenyl)methanol |
|
| Product Name | (2-morpholinophenyl)methanol |
| Synonyms | (2-morpholin-4-ylphenyl)methanol |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.2423 |
| InChl | InChI=1/C11H15NO2/c13-9-10-3-1-2-4-11(10)12-5-7-14-8-6-12/h1-4,13H,5-9H2 |
| CAS Registry Number | 465514-33-4 |
| Molecular Structure |  |
| Density | 1.16g/cm3 |
| Melting Point | 54℃ |
| Boiling Point | 362.8°C at 760 mmHg |
| Refractive Index | 1.568 |
| Flash Point | 173.2°C |
| Vapour Pressur | 6.7E-06mmHg at 25°C |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Beijing Ouhe Technology Co., Ltd.
TEL:0086-10-87149610 88459036
FAX:0086-10-88459036 - SynChem Inc.
TEL:847-298-2436
FAX:847-298-2439
