4819-69-6 N-(4-Chloro-2-butynyl)phthalimide |
|
| Product Name | N-(4-Chloro-2-butynyl)phthalimide |
| Synonyms | 1-Chloro-4-(N-phthalimido)-2-butyne;2-(4-chlorobut-2-yn-1-yl)-1H-isoindole-1,3(2H)-dione |
| Molecular Formula | C12H8ClNO2 |
| Molecular Weight | 233.6504 |
| InChl | InChI=1/C12H8ClNO2/c13-7-3-4-8-14-11(15)9-5-1-2-6-10(9)12(14)16/h1-2,5-6H,7-8H2 |
| CAS Registry Number | 4819-69-6 |
| Molecular Structure |  |
| Density | 1.391g/cm3 |
| Boiling Point | 389.3°C at 760 mmHg |
| Refractive Index | 1.621 |
| Flash Point | 189.2°C |
| Vapour Pressur | 2.88E-06mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
- J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431