50262-48-1 4-(Propionyloxy)-benzaldehyde |
| Product Name |
4-(Propionyloxy)-benzaldehyde |
| Synonyms |
4-Propionyloxybenzaldehyde;4-Hydroxybenzaldehyde propionate;4-formylphenyl propanoate |
| Molecular Formula |
C10H10O3 |
| Molecular Weight |
178.1846 |
| InChl |
InChI=1/C10H10O3/c1-2-10(12)13-9-5-3-8(7-11)4-6-9/h3-7H,2H2,1H3 |
| CAS Registry Number |
50262-48-1 |
| Molecular Structure |
 |
| Density |
1.147g/cm3 |
| Boiling Point |
289.6°C at 760 mmHg |
| Refractive Index |
1.543 |
| Flash Point |
126.1°C |
| Vapour Pressur |
0.00218mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
