5182-44-5 3-Chlorophenethylalcohol |
| Product Name |
3-Chlorophenethylalcohol |
| Synonyms |
3-Chlorophenethyl alcohol;2-(3-Chlorophenyl)ethanol |
| Molecular Formula |
C8H9ClO |
| Molecular Weight |
156.6095 |
| InChl |
InChI=1/C8H9ClO/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6,10H,4-5H2 |
| CAS Registry Number |
5182-44-5 |
| EINECS |
225-964-1 |
| Molecular Structure |
 |
| Density |
1.189g/cm3 |
| Boiling Point |
257.2°C at 760 mmHg |
| Refractive Index |
1.554 |
| Flash Point |
101.1°C |
| Vapour Pressur |
0.00756mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
