527-61-7 2,6-Dimethylbenzoquinone |
|
| Product Name | 2,6-Dimethylbenzoquinone |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 |
| InChl | InChI=1/C8H8O2/c1-5-3-7(9)4-6(2)8(5)10/h3-4H,1-2H3 |
| CAS Registry Number | 527-61-7 |
| EINECS | 208-420-8 |
| Molecular Structure |  |
| Melting Point | 69-74℃ |
| Hazard Symbols |  Xi##Irritant:; |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
- Agfa-Labs
TEL:+32(03)444 32 98
FAX:
