56540-70-6 1-benzofuran-5-carbonyl chloride |
|
| Product Name | 1-benzofuran-5-carbonyl chloride |
| Molecular Formula | C9H5ClO2 |
| Molecular Weight | 180.5878 |
| InChl | InChI=1/C9H5ClO2/c10-9(11)7-1-2-8-6(5-7)3-4-12-8/h1-5H |
| CAS Registry Number | 56540-70-6 |
| Molecular Structure |  |
| Density | 1.36g/cm3 |
| Melting Point | 67℃ |
| Boiling Point | 260.8°C at 760 mmHg |
| Refractive Index | 1.62 |
| Flash Point | 111.6°C |
| Vapour Pressur | 0.0119mmHg at 25°C |
| Hazard Symbols |  C##Corrosive:; |
| Risk Codes | R34##Causes burns.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
- J&H Chemical Co.,ltd
TEL:+86-571-87396430 / 87396432
FAX:+86-571-87396431