71486-46-9 oleic acid, compound with N-methylcyclohexylamine (1:1) |
|
Product Name | oleic acid, compound with N-methylcyclohexylamine (1:1) |
Synonyms | Oleic acid, compound with N-methylcyclohexylamine (1:1);N-methylcyclohexanamine; (Z)-octadec-9-enoic acid |
Molecular Formula | C25H49NO2 |
Molecular Weight | 395.6621 |
InChl | InChI=1/C18H34O2.C7H15N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-8-7-5-3-2-4-6-7/h9-10H,2-8,11-17H2,1H3,(H,19,20);7-8H,2-6H2,1H3/b10-9-; |
CAS Registry Number | 71486-46-9 |
EINECS | 275-519-0 |
Molecular Structure | |
Boiling Point | 496.8°C at 760 mmHg |
Flash Point | 254.3°C |
Vapour Pressur | 3.18E-11mmHg at 25°C |