7423-93-0 3-Chloro-L-tyrosine |
|
| Product Name | 3-Chloro-L-tyrosine |
| Synonyms | 3-Chloro-4-hydroxy-L-phenylalanine~H-Tyr(3-Cl)-OH;3-chlorotyrosine;H-Tyr(3-Cl)-OH |
| Molecular Formula | C9H10ClNO3 |
| Molecular Weight | 215.6336 |
| InChl | InChI=1/C9H10ClNO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14) |
| CAS Registry Number | 7423-93-0 |
| EINECS | 231-050-3 |
| Molecular Structure |  |
| Density | 1.458g/cm3 |
| Melting Point | 249℃ |
| Boiling Point | 388.6°C at 760 mmHg |
| Refractive Index | 1.625 |
| Flash Point | 188.8°C |
| Vapour Pressur | 9.81E-07mmHg at 25°C |
| Safety Description | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
- Pharmasyn
TEL:847-918-9018
FAX:847-918-1610
