78525-16-3 5-oxo-DL-proline, compound with ethyl N2-undecanoyl-L-argininate (1:1) |
|
Product Name | 5-oxo-DL-proline, compound with ethyl N2-undecanoyl-L-argininate (1:1) |
Synonyms | 5-Oxo-DL-proline, compound with ethyl N2-undecanoyl-L-argininate (1:1);ethyl (2S)-5-guanidino-2-(undecanoylamino)pentanoate; (2S)-5-oxopyrrolidine-2-carboxylic acid |
Molecular Formula | C24H45N5O6 |
Molecular Weight | 499.644 |
InChl | InChI=1/C19H38N4O3.C5H7NO3/c1-3-5-6-7-8-9-10-11-14-17(24)23-16(18(25)26-4-2)13-12-15-22-19(20)21;7-4-2-1-3(6-4)5(8)9/h16H,3-15H2,1-2H3,(H,23,24)(H4,20,21,22);3H,1-2H2,(H,6,7)(H,8,9)/t16-;3-/m00/s1 |
CAS Registry Number | 78525-16-3 |
EINECS | 278-935-0 |
Molecular Structure | |
Boiling Point | 737.5°C at 760 mmHg |
Flash Point | 399.8°C |
Vapour Pressur | 8.48E-24mmHg at 25°C |