78535-49-6 5-oxo-DL-proline, compound with ethyl N2-lauroyl-L-lysinate (1:1) |
|
Product Name | 5-oxo-DL-proline, compound with ethyl N2-lauroyl-L-lysinate (1:1) |
Synonyms | 5-Oxo-DL-proline, compound with ethyl N2-lauroyl-L-lysinate (1:1);ethyl (2S)-6-amino-2-(dodecanoylamino)hexanoate; (2S)-5-oxopyrrolidine-2-carboxylic acid |
Molecular Formula | C25H47N3O6 |
Molecular Weight | 485.6572 |
InChl | InChI=1/C20H40N2O3.C5H7NO3/c1-3-5-6-7-8-9-10-11-12-16-19(23)22-18(15-13-14-17-21)20(24)25-4-2;7-4-2-1-3(6-4)5(8)9/h18H,3-17,21H2,1-2H3,(H,22,23);3H,1-2H2,(H,6,7)(H,8,9)/t18-;3-/m00/s1 |
CAS Registry Number | 78535-49-6 |
EINECS | 278-940-8 |
Molecular Structure | |
Boiling Point | 702.6°C at 760 mmHg |
Flash Point | 378.7°C |
Vapour Pressur | 1.31E-21mmHg at 25°C |