82-05-3 Benzanthrone |
| Product Name |
Benzanthrone |
| Synonyms |
7H-Benz[de]anthracen-7-one;Benzanthrone,98%;benz(d e)anthracen-7-one;7H-benzo[de]anthracen-7-one |
| Molecular Formula |
C17H10O |
| Molecular Weight |
230.2607 |
| InChl |
InChI=1/C17H10O/c18-17-14-8-2-1-7-12(14)13-9-3-5-11-6-4-10-15(17)16(11)13/h1-10H |
| CAS Registry Number |
82-05-3 |
| EINECS |
201-393-3 |
| Molecular Structure |
 |
| Density |
1.286g/cm3 |
| Melting Point |
170℃ |
| Boiling Point |
436.2°C at 760 mmHg |
| Refractive Index |
1.734 |
| Flash Point |
196.1°C |
| Vapour Pressur |
8.27E-08mmHg at 25°C |
| Safety Description |
S24/25##Avoid contact with skin and eyes.:;
|
