89581-82-8 2-Acetyl-3-chlorothiophene |
|
| Product Name | 2-Acetyl-3-chlorothiophene |
| Synonyms | 1-(3-chlorothiophen-2-yl)ethanone |
| Molecular Formula | C6H5ClOS |
| Molecular Weight | 160.6213 |
| InChl | InChI=1/C6H5ClOS/c1-4(8)6-5(7)2-3-9-6/h2-3H,1H3 |
| CAS Registry Number | 89581-82-8 |
| Molecular Structure |  |
| Density | 1.312g/cm3 |
| Boiling Point | 219.9°C at 760 mmHg |
| Refractive Index | 1.559 |
| Flash Point | 86.8°C |
| Vapour Pressur | 0.116mmHg at 25°C |
| Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Safety Description | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
- Shanghai Rainbow Chemicals Co., Ltd.,
TEL:021-64965859
FAX:021-64968087
