90-31-3 1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one |
| Product Name |
1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one |
| Synonyms |
2-(3-Chlorophenyl)-2,4-dihydro-5-methyl-3H-pyrazol-3-one;1-(3'-Chlorophenyl)-3-methyl-5-pyrazolone;2-(3-chlorophenyl)-5-methyl-2,4-dihydro-3H-pyrazol-3-one;1-(3-Chlorophenyl)-3-Methyl-4,5-Dihydro-1H-Pyrazol-5-One;1-(3-Chlorophenyl)-3-Methyl-5-Pyrazolone |
| Molecular Formula |
C10H9ClN2O |
| Molecular Weight |
208.6443 |
| InChl |
InChI=1/C10H9ClN2O/c1-7-5-10(14)13(12-7)9-4-2-3-8(11)6-9/h2-4,6H,5H2,1H3 |
| CAS Registry Number |
90-31-3 |
| EINECS |
201-984-6 |
| Molecular Structure |
 |
| Density |
1.32g/cm3 |
| Melting Point |
128-131℃ |
| Boiling Point |
382.9°C at 760 mmHg |
| Refractive Index |
1.625 |
| Flash Point |
185.4°C |
| Vapour Pressur |
4.57E-06mmHg at 25°C |
| Safety Description |
S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:;
|
