98510-86-2 bis(sec-butyl) hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1) |
Product Name |
bis(sec-butyl) hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1) |
Synonyms |
Bis(sec-butyl) hydrogen phosphate, compound with 2-ethyl-N-(2-ethylhexyl)hexylamine (1:1);disec-butyl hydrogen phosphate; 2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
Molecular Formula |
C24H54NO4P |
Molecular Weight |
451.6636 |
InChl |
InChI=1/C16H35N.C8H19O4P/c1-5-9-11-15(7-3)13-17-14-16(8-4)12-10-6-2;1-5-7(3)11-13(9,10)12-8(4)6-2/h15-17H,5-14H2,1-4H3;7-8H,5-6H2,1-4H3,(H,9,10) |
CAS Registry Number |
98510-86-2 |
EINECS |
308-794-3 |
Molecular Structure |
|
Boiling Point |
508.1°C at 760 mmHg |
Flash Point |
261.1°C |
Vapour Pressur |
1.07E-11mmHg at 25°C |