ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
589-62-8 4-octanol |
|
| Chemical Name | 4-octanol |
| Synonyms | n-Butyl n-propyl carbinol;octan-4-ol |
| Molecular Formula | C8H18O |
| Molecular Weight | 130.2279 |
| InChl | InChI=1/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 |
| CAS Registry Number | 589-62-8 |
| EINECS | 209-654-3 |
| Molecular Structure | ![]() |
| Density | 0.821g/cm3 |
| Boiling Point | 179.2°C at 760 mmHg |
| Refractive Index | 1.426 |
| Flash Point | 71.1°C |
| Vapour Pressur | 0.284mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Description | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |