100-76-5 quinuclidine |
|
| Product Name | quinuclidine |
| Synonyms | 1-azabicyclo[2.2.2]octane |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.1848 |
| InChl | InChI=1/C7H13N/c1-4-8-5-2-7(1)3-6-8/h7H,1-6H2 |
| CAS Registry Number | 100-76-5 |
| EINECS | 202-887-1 |
| Molecular Structure |  |
| Density | 0.97g/cm3 |
| Melting Point | 157-160℃ |
| Boiling Point | 149.5°C at 760 mmHg |
| Refractive Index | 1.512 |
| Flash Point | 36.5°C |
| Vapour Pressur | 4.01mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
