101-69-9 variamine blue B salt |
|
Product Name | variamine blue B salt |
Synonyms | Variamine blue diazonium salt;4-[(4-methoxyphenyl)amino]benzenediazonium chloride |
Molecular Formula | C13H12ClN3O |
Molecular Weight | 261.7069 |
InChl | InChI=1/C13H12N3O.ClH/c1-17-13-8-6-11(7-9-13)15-10-2-4-12(16-14)5-3-10;/h2-9,15H,1H3;1H/q+1;/p-1 |
CAS Registry Number | 101-69-9 |
EINECS | 202-967-6 |
Molecular Structure | |
MSDS |
- If you plan to source variamine blue B salt 101-69-9 from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall