114-32-9 (2-ethylphenyl)urea |
|
| Product Name | (2-ethylphenyl)urea |
| Synonyms | (2-Ethylphenyl)urea;1-(2-ethylphenyl)urea |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.2044 |
| InChl | InChI=1/C9H12N2O/c1-2-7-5-3-4-6-8(7)11-9(10)12/h3-6H,2H2,1H3,(H3,10,11,12) |
| CAS Registry Number | 114-32-9 |
| EINECS | 204-045-9 |
| Molecular Structure |  |
| Density | 1.152g/cm3 |
| Boiling Point | 267.6°C at 760 mmHg |
| Refractive Index | 1.603 |
| Flash Point | 115.7°C |
| Vapour Pressur | 0.00807mmHg at 25°C |
- If you plan to source chemicals from China, just go to ChemNet mall, we will get the latest and competitive price from China manufacturers for you. Please visit
ChemNet Mall
