ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
115398-85-1 2-({1-[(4-methylpiperazin-1-yl)methyl]-1H-benzimidazol-2-yl}methyl)-5-nitro-1H-isoindole-1,3(2H)-dione |
|
| Chemical Name | 2-({1-[(4-methylpiperazin-1-yl)methyl]-1H-benzimidazol-2-yl}methyl)-5-nitro-1H-isoindole-1,3(2H)-dione |
| Synonyms | 1H-Isoindole-1,3(2H)-dione, 2-((1-((4-methyl-1-piperazinyl)methyl)-1H-benzimidazol-2-yl)methyl)-5-nitro- |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.4479 |
| InChl | InChI=1/C22H22N6O4/c1-24-8-10-25(11-9-24)14-27-19-5-3-2-4-18(19)23-20(27)13-26-21(29)16-7-6-15(28(31)32)12-17(16)22(26)30/h2-7,12H,8-11,13-14H2,1H3 |
| CAS Registry Number | 115398-85-1 |
| Molecular Structure | ![]() |
| Density | 1.49g/cm3 |
| Boiling Point | 647.3°C at 760 mmHg |
| Refractive Index | 1.739 |
| Flash Point | 345.3°C |
| Vapour Pressur | 1.22E-16mmHg at 25°C |
| MSDS | |