ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
124668-49-1 N,N-dimethylazetidin-3-amine dihydrochloride |
|
| Chemical Name | N,N-dimethylazetidin-3-amine dihydrochloride |
| Synonyms | 3-(Dimethylamino)azetidinedihydrochloride;3-Azetidinamine, N,N-dimethyl-, dihydrochloride;3-(Dimethylamino)azetidine 2HCl |
| Molecular Formula | C5H14N2CL2 |
| Molecular Weight | 173.08556 |
| InChl | InChI=1/C5H12N2/c1-7(2)5-3-6-4-5/h5-6H,3-4H2,1-2H3 |
| CAS Registry Number | 124668-49-1 |
| Molecular Structure | ![]() |
| Density | 0.933g/cm3 |
| Boiling Point | 138.528°C at 760 mmHg |
| Refractive Index | 1.483 |
| Flash Point | 47.914°C |
| Vapour Pressur | 6.701mmHg at 25°C |
| MSDS | |