ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
13694-51-4 1-(4-fluorophenyl)-4-(2-methoxy-2-phenyl-ethyl)piperazine hydrochloride |
|
| Chemical Name | 1-(4-fluorophenyl)-4-(2-methoxy-2-phenyl-ethyl)piperazine hydrochloride |
| Synonyms | Piperazine, 1-(p-fluorophenyl)-4-(beta-methoxyphenethyl)-, monohydrochloride;1-(p-Fluorophenyl)-4-(beta-methoxyphenethyl)piperazine monohydrochloride;1-(4-fluorophenyl)-4-(2-methoxy-2-phenylethyl)piperazine hydrochloride (1:1) |
| Molecular Formula | C19H24ClFN2O |
| Molecular Weight | 350.8581 |
| InChl | InChI=1/C19H23FN2O.ClH/c1-23-19(16-5-3-2-4-6-16)15-21-11-13-22(14-12-21)18-9-7-17(20)8-10-18;/h2-10,19H,11-15H2,1H3;1H |
| CAS Registry Number | 13694-51-4 |
| Molecular Structure | ![]() |
| Boiling Point | 421.3°C at 760 mmHg |
| Flash Point | 208.6°C |
| Vapour Pressur | 2.64E-07mmHg at 25°C |
| MSDS | |