ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1405-52-3 sulfomyxin |
|
| Chemical Name | sulfomyxin |
| Synonyms | Sulfomyxin [USAN:INN];Pentakis(N-sulfomethyl)polymyxin B;Sulfomyxin;Sulfomyxina;Sulfomyxinum;Sulphomyxin |
| Molecular Formula | C53H92N16O13 |
| Molecular Weight | 1161.4088 |
| InChl | InChI=1/C53H92N16O13/c1-6-7-9-14-41(72)60-33(15-21-54)48(77)69-43(31(5)71)53(82)65-36(18-24-57)45(74)64-38-20-26-59-52(81)42(30(4)70)68-49(78)37(19-25-58)62-44(73)34(16-22-55)63-50(79)39(27-29(2)3)66-51(80)40(28-32-12-10-8-11-13-32)67-46(75)35(17-23-56)61-47(38)76/h8,10-13,29-31,33-40,42-43,70-71H,6-7,9,14-28,54-58H2,1-5H3,(H,59,81)(H,60,72)(H,61,76)(H,62,73)(H,63,79)(H,64,74)(H,65,82)(H,66,80)(H,67,75)(H,68,78)(H,69,77)/t30-,31-,33+,34+,35+,36+,37+,38+,39+,40+,42+,43+/m1/s1 |
| CAS Registry Number | 1405-52-3 |
| Molecular Structure | ![]() |
| MSDS | |