14263-94-6 Fast Blue B zinc salt |
|
Product Name | Fast Blue B zinc salt |
Molecular Formula | C14H12Cl4N4O2Zn |
Molecular Weight | 475.4917 |
InChl | InChI=1/C14H12N4O2.4ClH.Zn/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2;;;;;/h3-8H,1-2H3;4*1H;/q+2;;;;;+2/p-4 |
CAS Registry Number | 14263-94-6 |
EINECS | 238-153-2 |
Molecular Structure | |
Melting Point | 300℃ |
Hazard Symbols | Xn##Harmful:; |
Risk Codes | R40##Possible risks of irreversible effects.:; |
Safety Description | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |